C45H68O3 — CID 159514042
4-[4,4-bis(5-tert-butyl-4-hydroxy-2-methylphenyl)-10-methylundecan-2-yl]-2-tert-butyl-5-methylphenol (PubChem CID 159514042) has the molecular formula C45H68O3 and a molecular weight of 657.04 g/mol. Its IUPAC name is 4-[4,4-bis(5-tert-butyl-4-hydroxy-2-methylphenyl)-10-methylundecan-2-yl]-2-tert-butyl-5-methylphenol.
| Compound Name | 4-[4,4-bis(5-tert-butyl-4-hydroxy-2-methylphenyl)-10-methylundecan-2-yl]-2-tert-butyl-5-methylphenol |
|---|---|
| PubChem CID | 159514042 |
| Molecular Formula | C45H68O3 |
| Molecular Weight | 657.04 g/mol |
| Exact Mass | 656.52 |
| IUPAC Name | 4-[4,4-bis(5-tert-butyl-4-hydroxy-2-methylphenyl)-10-methylundecan-2-yl]-2-tert-butyl-5-methylphenol |
| SMILES | Cc1cc(O)c(C(C)(C)C)cc1C(C)CC(CCCCCC(C)C)(c1cc(C(C)(C)C)c(O)cc1C)c1cc(C(C)(C)C)c(O)cc1C |
| InChI | InChI=1S/C45H68O3/c1-28(2)19-17-16-18-20-45(34-25-37(43(10,11)12)40(47)22-30(34)4,35-26-38(44(13,14)15)41(48)23-31(35)5)27-32(6)33-24-36(42(7,8)9)39(46)21-29(33)3/h21-26,28,32,46-48H,16-20,27H2,1-15H3 |
| InChIKey | PJGAWWGCEAFOHA-UHFFFAOYSA-N |
| XLogP | 12.71 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.04 |
| LogP ≤ 5 | 12.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|