C37H53O5P — CID 87663978
[4-[1,3-bis(5-tert-butyl-4-hydroxy-2-methylphenyl)butyl]-2-tert-butyl-5-methylphenyl] dihydrogen phosphite (PubChem CID 87663978) has the molecular formula C37H53O5P and a molecular weight of 608.80 g/mol. Its IUPAC name is [4-[1,3-bis(5-tert-butyl-4-hydroxy-2-methylphenyl)butyl]-2-tert-butyl-5-methylphenyl] dihydrogen phosphite.
| Compound Name | [4-[1,3-bis(5-tert-butyl-4-hydroxy-2-methylphenyl)butyl]-2-tert-butyl-5-methylphenyl] dihydrogen phosphite |
|---|---|
| PubChem CID | 87663978 |
| Molecular Formula | C37H53O5P |
| Molecular Weight | 608.80 g/mol |
| Exact Mass | 608.36 |
| IUPAC Name | [4-[1,3-bis(5-tert-butyl-4-hydroxy-2-methylphenyl)butyl]-2-tert-butyl-5-methylphenyl] dihydrogen phosphite |
| SMILES | Cc1cc(O)c(C(C)(C)C)cc1C(C)CC(c1cc(C(C)(C)C)c(O)cc1C)c1cc(C(C)(C)C)c(OP(O)O)cc1C |
| InChI | InChI=1S/C37H53O5P/c1-21(25-18-29(35(5,6)7)32(38)15-22(25)2)14-28(26-19-30(36(8,9)10)33(39)16-23(26)3)27-20-31(37(11,12)13)34(17-24(27)4)42-43(40)41/h15-21,28,38-41H,14H2,1-13H3 |
| InChIKey | JGTXETLBLJRWFS-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.80 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|