C52H76O9 — CID 145376255
[4-[1,3-bis[5-tert-butyl-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]butyl]-2-butyl-5-methylphenyl] tert-butyl carbonate (PubChem CID 145376255) has the molecular formula C52H76O9 and a molecular weight of 845.17 g/mol. Its IUPAC name is [4-[1,3-bis[5-tert-butyl-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]butyl]-2-butyl-5-methylphenyl] tert-butyl carbonate.
| Compound Name | [4-[1,3-bis[5-tert-butyl-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]butyl]-2-butyl-5-methylphenyl] tert-butyl carbonate |
|---|---|
| PubChem CID | 145376255 |
| Molecular Formula | C52H76O9 |
| Molecular Weight | 845.17 g/mol |
| Exact Mass | 844.55 |
| IUPAC Name | [4-[1,3-bis[5-tert-butyl-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]butyl]-2-butyl-5-methylphenyl] tert-butyl carbonate |
| SMILES | CCCCc1cc(C(CC(C)c2cc(C(C)(C)C)c(OC(=O)OC(C)(C)C)cc2C)c2cc(C(C)(C)C)c(OC(=O)OC(C)(C)C)cc2C)c(C)cc1OC(=O)OC(C)(C)C |
| InChI | InChI=1S/C52H76O9/c1-21-22-23-35-28-37(33(4)25-42(35)56-45(53)59-50(12,13)14)39(38-30-41(49(9,10)11)44(27-34(38)5)58-47(55)61-52(18,19)20)24-31(2)36-29-40(48(6,7)8)43(26-32(36)3)57-46(54)60-51(15,16)17/h25-31,39H,21-24H2,1-20H3 |
| InChIKey | IPNGKAKVMJCKQB-UHFFFAOYSA-N |
| XLogP | 14.82 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.17 |
| LogP ≤ 5 | 14.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|