C19H32O2 — CID 21395972
2,6-ditert-butyl-4-(3-hydroxypentyl)phenol (PubChem CID 21395972) has the molecular formula C19H32O2 and a molecular weight of 292.46 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-(3-hydroxypentyl)phenol.
| Compound Name | 2,6-ditert-butyl-4-(3-hydroxypentyl)phenol |
|---|---|
| PubChem CID | 21395972 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | 2,6-ditert-butyl-4-(3-hydroxypentyl)phenol |
| SMILES | CCC(O)CCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H32O2/c1-8-14(20)10-9-13-11-15(18(2,3)4)17(21)16(12-13)19(5,6)7/h11-12,14,20-21H,8-10H2,1-7H3 |
| InChIKey | RCAVPMZKWOKDIT-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |