C73H108O12 — CID 57126934
1,9-bis(3,5-ditert-butyl-4-hydroxyphenyl)-5,5-bis[4-(3,5-ditert-butyl-4-hydroxyphenyl)-2-hydroxybutanoyl]-3,7-dihydroxynonane-4,6-dione (PubChem CID 57126934) has the molecular formula C73H108O12 and a molecular weight of 1177.65 g/mol. Its IUPAC name is 1,9-bis(3,5-ditert-butyl-4-hydroxyphenyl)-5,5-bis[4-(3,5-ditert-butyl-4-hydroxyphenyl)-2-hydroxybutanoyl]-3,7-dihydroxynonane-4,6-dione.
| Compound Name | 1,9-bis(3,5-ditert-butyl-4-hydroxyphenyl)-5,5-bis[4-(3,5-ditert-butyl-4-hydroxyphenyl)-2-hydroxybutanoyl]-3,7-dihydroxynonane-4,6-dione |
|---|---|
| PubChem CID | 57126934 |
| Molecular Formula | C73H108O12 |
| Molecular Weight | 1177.65 g/mol |
| Exact Mass | 1176.78 |
| IUPAC Name | 1,9-bis(3,5-ditert-butyl-4-hydroxyphenyl)-5,5-bis[4-(3,5-ditert-butyl-4-hydroxyphenyl)-2-hydroxybutanoyl]-3,7-dihydroxynonane-4,6-dione |
| SMILES | CC(C)(C)c1cc(CCC(O)C(=O)C(C(=O)C(O)CCc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)(C(=O)C(O)CCc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)C(=O)C(O)CCc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C73H108O12/c1-65(2,3)45-33-41(34-46(57(45)78)66(4,5)6)25-29-53(74)61(82)73(62(83)54(75)30-26-42-35-47(67(7,8)9)58(79)48(36-42)68(10,11)12,63(84)55(76)31-27-43-37-49(69(13,14)15)59(80)50(38-43)70(16,17)18)64(85)56(77)32-28-44-39-51(71(19,20)21)60(81)52(40-44)72(22,23)24/h33-40,53-56,74-81H,25-32H2,1-24H3 |
| InChIKey | LNCYRMGKDKFMNC-UHFFFAOYSA-N |
| XLogP | 13.43 |
| TPSA | 230.12 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 85 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1177.65 |
| LogP ≤ 5 | 13.43 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|