C21H34O3S — CID 54480918
4-(3,5-ditert-butyl-4-hydroxyphenyl)butan-2-yl 3-sulfanylpropanoate (PubChem CID 54480918) has the molecular formula C21H34O3S and a molecular weight of 366.57 g/mol. Its IUPAC name is 4-(3,5-ditert-butyl-4-hydroxyphenyl)butan-2-yl 3-sulfanylpropanoate.
| Compound Name | 4-(3,5-ditert-butyl-4-hydroxyphenyl)butan-2-yl 3-sulfanylpropanoate |
|---|---|
| PubChem CID | 54480918 |
| Molecular Formula | C21H34O3S |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 4-(3,5-ditert-butyl-4-hydroxyphenyl)butan-2-yl 3-sulfanylpropanoate |
| SMILES | CC(CCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)OC(=O)CCS |
| InChI | InChI=1S/C21H34O3S/c1-14(24-18(22)10-11-25)8-9-15-12-16(20(2,3)4)19(23)17(13-15)21(5,6)7/h12-14,23,25H,8-11H2,1-7H3 |
| InChIKey | XOXZKRLTVGADPR-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|