C23H38O8 — CID 87968757
[(2R,3R,4R,5S)-1,2,4,5,6-pentahydroxyhexan-3-yl] 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate (PubChem CID 87968757) has the molecular formula C23H38O8 and a molecular weight of 442.55 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-1,2,4,5,6-pentahydroxyhexan-3-yl] 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate.
| Compound Name | [(2R,3R,4R,5S)-1,2,4,5,6-pentahydroxyhexan-3-yl] 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 87968757 |
| Molecular Formula | C23H38O8 |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | [(2R,3R,4R,5S)-1,2,4,5,6-pentahydroxyhexan-3-yl] 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate |
| SMILES | CC(C)(C)c1cc(CCC(=O)O[C@@H]([C@H](O)[C@@H](O)CO)[C@H](O)CO)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C23H38O8/c1-22(2,3)14-9-13(10-15(19(14)29)23(4,5)6)7-8-18(28)31-21(17(27)12-25)20(30)16(26)11-24/h9-10,16-17,20-21,24-27,29-30H,7-8,11-12H2,1-6H3/t16-,17+,20+,21+/m0/s1 |
| InChIKey | OOCXGPNRMVVAPT-XWDORNJCSA-N |
| XLogP | 0.90 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |