C26H44O5 — CID 57264386
(5,5-dihydroxy-3,3,4,4-tetramethylpentyl) 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate (PubChem CID 57264386) has the molecular formula C26H44O5 and a molecular weight of 436.63 g/mol. Its IUPAC name is (5,5-dihydroxy-3,3,4,4-tetramethylpentyl) 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate.
| Compound Name | (5,5-dihydroxy-3,3,4,4-tetramethylpentyl) 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 57264386 |
| Molecular Formula | C26H44O5 |
| Molecular Weight | 436.63 g/mol |
| Exact Mass | 436.32 |
| IUPAC Name | (5,5-dihydroxy-3,3,4,4-tetramethylpentyl) 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate |
| SMILES | CC(C)(C)c1cc(CCC(=O)OCCC(C)(C)C(C)(C)C(O)O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C26H44O5/c1-23(2,3)18-15-17(16-19(21(18)28)24(4,5)6)11-12-20(27)31-14-13-25(7,8)26(9,10)22(29)30/h15-16,22,28-30H,11-14H2,1-10H3 |
| InChIKey | XPBXLXDGGMHBBK-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.63 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|