C23H38O9 — CID 174350631
[(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl] 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate (PubChem CID 174350631) has the molecular formula C23H38O9 and a molecular weight of 458.55 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl] 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate.
| Compound Name | [(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl] 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 174350631 |
| Molecular Formula | C23H38O9 |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | [(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl] 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate |
| SMILES | CC(C)(C)c1cc(CCC(=O)OC(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C23H38O9/c1-22(2,3)13-9-12(10-14(17(13)27)23(4,5)6)7-8-16(26)32-21(31)20(30)19(29)18(28)15(25)11-24/h9-10,15,18-21,24-25,27-31H,7-8,11H2,1-6H3/t15-,18-,19+,20-,21?/m1/s1 |
| InChIKey | RIPCIRQQZIMUBL-IJFYFLOXSA-N |
| XLogP | 0.22 |
| TPSA | 167.91 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|