C21H30O8S — CID 54311988
2-[carboxy-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]methyl]sulfanyl-2-hydroxyacetic acid (PubChem CID 54311988) has the molecular formula C21H30O8S and a molecular weight of 442.53 g/mol. Its IUPAC name is 2-[carboxy-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]methyl]sulfanyl-2-hydroxyacetic acid.
| Compound Name | 2-[carboxy-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]methyl]sulfanyl-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 54311988 |
| Molecular Formula | C21H30O8S |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 2-[carboxy-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]methyl]sulfanyl-2-hydroxyacetic acid |
| SMILES | CC(C)(C)c1cc(CCC(=O)OC(SC(O)C(=O)O)C(=O)O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C21H30O8S/c1-20(2,3)12-9-11(10-13(15(12)23)21(4,5)6)7-8-14(22)29-19(17(26)27)30-18(28)16(24)25/h9-10,18-19,23,28H,7-8H2,1-6H3,(H,24,25)(H,26,27) |
| InChIKey | SLNUFDWMDKOKBZ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|