C22H32O5 — CID 58798051
1,5-dioxopentan-3-yl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate (PubChem CID 58798051) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is 1,5-dioxopentan-3-yl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate.
| Compound Name | 1,5-dioxopentan-3-yl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 58798051 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 1,5-dioxopentan-3-yl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate |
| SMILES | CC(C)(C)c1cc(CCC(=O)OC(CC=O)CC=O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C22H32O5/c1-21(2,3)17-13-15(14-18(20(17)26)22(4,5)6)7-8-19(25)27-16(9-11-23)10-12-24/h11-14,16,26H,7-10H2,1-6H3 |
| InChIKey | MASLAMYXGJOEGV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|