C76H114O12 — CID 129150098
4,6,8-tris[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]octyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate (PubChem CID 129150098) has the molecular formula C76H114O12 and a molecular weight of 1219.74 g/mol. Its IUPAC name is 4,6,8-tris[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]octyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate.
| Compound Name | 4,6,8-tris[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]octyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 129150098 |
| Molecular Formula | C76H114O12 |
| Molecular Weight | 1219.74 g/mol |
| Exact Mass | 1218.83 |
| IUPAC Name | 4,6,8-tris[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]octyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate |
| SMILES | CC(C)(C)c1cc(CCC(=O)OCCCC(CC(CCOC(=O)CCc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)OC(=O)CCc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)OC(=O)CCc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C76H114O12/c1-69(2,3)53-38-47(39-54(65(53)81)70(4,5)6)27-31-61(77)85-36-25-26-51(87-63(79)33-29-49-42-57(73(13,14)15)67(83)58(43-49)74(16,17)18)46-52(88-64(80)34-30-50-44-59(75(19,20)21)68(84)60(45-50)76(22,23)24)35-37-86-62(78)32-28-48-40-55(71(7,8)9)66(82)56(41-48)72(10,11)12/h38-45,51-52,81-84H,25-37,46H2,1-24H3 |
| InChIKey | AAAUEYPPGRVMKF-UHFFFAOYSA-N |
| XLogP | 17.19 |
| TPSA | 186.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 88 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1219.74 |
| LogP ≤ 5 | 17.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|