C40H61NO6 — CID 142899910
6-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]hexyl 3-(3,5-ditert-butyl-4-nitrosophenyl)propanoate (PubChem CID 142899910) has the molecular formula C40H61NO6 and a molecular weight of 651.93 g/mol. Its IUPAC name is 6-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]hexyl 3-(3,5-ditert-butyl-4-nitrosophenyl)propanoate.
| Compound Name | 6-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]hexyl 3-(3,5-ditert-butyl-4-nitrosophenyl)propanoate |
|---|---|
| PubChem CID | 142899910 |
| Molecular Formula | C40H61NO6 |
| Molecular Weight | 651.93 g/mol |
| Exact Mass | 651.45 |
| IUPAC Name | 6-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]hexyl 3-(3,5-ditert-butyl-4-nitrosophenyl)propanoate |
| SMILES | CC(C)(C)c1cc(CCC(=O)OCCCCCCOC(=O)CCc2cc(C(C)(C)C)c(N=O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C40H61NO6/c1-37(2,3)29-23-27(24-30(35(29)41-45)38(4,5)6)17-19-33(42)46-21-15-13-14-16-22-47-34(43)20-18-28-25-31(39(7,8)9)36(44)32(26-28)40(10,11)12/h23-26,44H,13-22H2,1-12H3 |
| InChIKey | LFCYOLDIEQPNAJ-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.93 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|