C21H34O5 — CID 15042016
(3R,5R)-7-(3,5-ditert-butyl-4-hydroxyphenyl)-3,5-dihydroxyheptanoic acid (PubChem CID 15042016) has the molecular formula C21H34O5 and a molecular weight of 366.50 g/mol. Its IUPAC name is (3R,5R)-7-(3,5-ditert-butyl-4-hydroxyphenyl)-3,5-dihydroxyheptanoic acid.
| Compound Name | (3R,5R)-7-(3,5-ditert-butyl-4-hydroxyphenyl)-3,5-dihydroxyheptanoic acid |
|---|---|
| PubChem CID | 15042016 |
| Molecular Formula | C21H34O5 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | (3R,5R)-7-(3,5-ditert-butyl-4-hydroxyphenyl)-3,5-dihydroxyheptanoic acid |
| SMILES | CC(C)(C)c1cc(CC[C@@H](O)C[C@@H](O)CC(=O)O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C21H34O5/c1-20(2,3)16-9-13(10-17(19(16)26)21(4,5)6)7-8-14(22)11-15(23)12-18(24)25/h9-10,14-15,22-23,26H,7-8,11-12H2,1-6H3,(H,24,25)/t14-,15-/m1/s1 |
| InChIKey | VEBFPTKGLXFTIZ-HUUCEWRRSA-N |
| XLogP | 3.51 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |