C28H48O3 — CID 54498839
10-methylundecyl 2-(3,5-ditert-butyl-4-hydroxyphenyl)acetate (PubChem CID 54498839) has the molecular formula C28H48O3 and a molecular weight of 432.69 g/mol. Its IUPAC name is 10-methylundecyl 2-(3,5-ditert-butyl-4-hydroxyphenyl)acetate.
| Compound Name | 10-methylundecyl 2-(3,5-ditert-butyl-4-hydroxyphenyl)acetate |
|---|---|
| PubChem CID | 54498839 |
| Molecular Formula | C28H48O3 |
| Molecular Weight | 432.69 g/mol |
| Exact Mass | 432.36 |
| IUPAC Name | 10-methylundecyl 2-(3,5-ditert-butyl-4-hydroxyphenyl)acetate |
| SMILES | CC(C)CCCCCCCCCOC(=O)Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C28H48O3/c1-21(2)16-14-12-10-9-11-13-15-17-31-25(29)20-22-18-23(27(3,4)5)26(30)24(19-22)28(6,7)8/h18-19,21,30H,9-17,20H2,1-8H3 |
| InChIKey | YBAAEUMXEKZSIK-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.69 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|