C25H44O3 — CID 175093324
2,6-ditert-butylphenol;6-methylheptyl propanoate (PubChem CID 175093324) has the molecular formula C25H44O3 and a molecular weight of 392.62 g/mol. Its IUPAC name is 2,6-ditert-butylphenol;6-methylheptyl propanoate.
| Compound Name | 2,6-ditert-butylphenol;6-methylheptyl propanoate |
|---|---|
| PubChem CID | 175093324 |
| Molecular Formula | C25H44O3 |
| Molecular Weight | 392.62 g/mol |
| Exact Mass | 392.33 |
| IUPAC Name | 2,6-ditert-butylphenol;6-methylheptyl propanoate |
| SMILES | CC(C)(C)c1cccc(C(C)(C)C)c1O.CCC(=O)OCCCCCC(C)C |
| InChI | InChI=1S/C14H22O.C11H22O2/c1-13(2,3)10-8-7-9-11(12(10)15)14(4,5)6;1-4-11(12)13-9-7-5-6-8-10(2)3/h7-9,15H,1-6H3;10H,4-9H2,1-3H3 |
| InChIKey | KPTFYMZKODQKBR-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.62 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|