C25H42O3 — CID 175136112
6-methylheptyl 3-tert-butyl-3-(4-hydroxyphenyl)-4,4-dimethylpentanoate (PubChem CID 175136112) has the molecular formula C25H42O3 and a molecular weight of 390.61 g/mol. Its IUPAC name is 6-methylheptyl 3-tert-butyl-3-(4-hydroxyphenyl)-4,4-dimethylpentanoate.
| Compound Name | 6-methylheptyl 3-tert-butyl-3-(4-hydroxyphenyl)-4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 175136112 |
| Molecular Formula | C25H42O3 |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.31 |
| IUPAC Name | 6-methylheptyl 3-tert-butyl-3-(4-hydroxyphenyl)-4,4-dimethylpentanoate |
| SMILES | CC(C)CCCCCOC(=O)CC(c1ccc(O)cc1)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C25H42O3/c1-19(2)12-10-9-11-17-28-22(27)18-25(23(3,4)5,24(6,7)8)20-13-15-21(26)16-14-20/h13-16,19,26H,9-12,17-18H2,1-8H3 |
| InChIKey | MCUIMCQTOUXIQE-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|