C26H48O7 — CID 14228650
2-hydroxy-4-(8-methylnonoxy)-2-[2-(8-methylnonoxy)-2-oxoethyl]-4-oxobutanoic acid (PubChem CID 14228650) has the molecular formula C26H48O7 and a molecular weight of 472.66 g/mol. Its IUPAC name is 2-hydroxy-4-(8-methylnonoxy)-2-[2-(8-methylnonoxy)-2-oxoethyl]-4-oxobutanoic acid.
| Compound Name | 2-hydroxy-4-(8-methylnonoxy)-2-[2-(8-methylnonoxy)-2-oxoethyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 14228650 |
| Molecular Formula | C26H48O7 |
| Molecular Weight | 472.66 g/mol |
| Exact Mass | 472.34 |
| IUPAC Name | 2-hydroxy-4-(8-methylnonoxy)-2-[2-(8-methylnonoxy)-2-oxoethyl]-4-oxobutanoic acid |
| SMILES | CC(C)CCCCCCCOC(=O)CC(O)(CC(=O)OCCCCCCCC(C)C)C(=O)O |
| InChI | InChI=1S/C26H48O7/c1-21(2)15-11-7-5-9-13-17-32-23(27)19-26(31,25(29)30)20-24(28)33-18-14-10-6-8-12-16-22(3)4/h21-22,31H,5-20H2,1-4H3,(H,29,30) |
| InChIKey | FVIKFIWWWPMPDM-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.66 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|