C20H36O7 — CID 167434714
2-[2-(6-butyldecoxy)-2-oxoethyl]-2-hydroxybutanedioic acid (PubChem CID 167434714) has the molecular formula C20H36O7 and a molecular weight of 388.50 g/mol. Its IUPAC name is 2-[2-(6-butyldecoxy)-2-oxoethyl]-2-hydroxybutanedioic acid.
| Compound Name | 2-[2-(6-butyldecoxy)-2-oxoethyl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 167434714 |
| Molecular Formula | C20H36O7 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | 2-[2-(6-butyldecoxy)-2-oxoethyl]-2-hydroxybutanedioic acid |
| SMILES | CCCCC(CCCC)CCCCCOC(=O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H36O7/c1-3-5-10-16(11-6-4-2)12-8-7-9-13-27-18(23)15-20(26,19(24)25)14-17(21)22/h16,26H,3-15H2,1-2H3,(H,21,22)(H,24,25) |
| InChIKey | GVEKOIFUYBKAGS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|