C14H24O8 — CID 90961121
2-hydroxy-2-[2-(3-hydroxyoctoxy)-2-oxoethyl]butanedioic acid (PubChem CID 90961121) has the molecular formula C14H24O8 and a molecular weight of 320.34 g/mol. Its IUPAC name is 2-hydroxy-2-[2-(3-hydroxyoctoxy)-2-oxoethyl]butanedioic acid.
| Compound Name | 2-hydroxy-2-[2-(3-hydroxyoctoxy)-2-oxoethyl]butanedioic acid |
|---|---|
| PubChem CID | 90961121 |
| Molecular Formula | C14H24O8 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 2-hydroxy-2-[2-(3-hydroxyoctoxy)-2-oxoethyl]butanedioic acid |
| SMILES | CCCCCC(O)CCOC(=O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C14H24O8/c1-2-3-4-5-10(15)6-7-22-12(18)9-14(21,13(19)20)8-11(16)17/h10,15,21H,2-9H2,1H3,(H,16,17)(H,19,20) |
| InChIKey | KDXGXZJFNZUCKX-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|