C19H32O16 — CID 87105338
heptane-1,2-diol;bis(2-hydroxypropane-1,2,3-tricarboxylic acid) (PubChem CID 87105338) has the molecular formula C19H32O16 and a molecular weight of 516.45 g/mol. Its IUPAC name is heptane-1,2-diol;bis(2-hydroxypropane-1,2,3-tricarboxylic acid).
| Compound Name | heptane-1,2-diol;bis(2-hydroxypropane-1,2,3-tricarboxylic acid) |
|---|---|
| PubChem CID | 87105338 |
| Molecular Formula | C19H32O16 |
| Molecular Weight | 516.45 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | heptane-1,2-diol;bis(2-hydroxypropane-1,2,3-tricarboxylic acid) |
| SMILES | CCCCCC(O)CO.O=C(O)CC(O)(CC(=O)O)C(=O)O.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C7H16O2.2C6H8O7/c1-2-3-4-5-7(9)6-8;2*7-3(8)1-6(13,5(11)12)2-4(9)10/h7-9H,2-6H2,1H3;2*13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | CQKMZSFTTREJSE-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 304.72 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.45 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|