C24H42O13 — CID 87823806
2-hydroxypropane-1,2,3-tricarboxylic acid;2-hydroxypropanoyl 2-(2,3-dihydroxypropyl)dodecanoate (PubChem CID 87823806) has the molecular formula C24H42O13 and a molecular weight of 538.59 g/mol. Its IUPAC name is 2-hydroxypropane-1,2,3-tricarboxylic acid;2-hydroxypropanoyl 2-(2,3-dihydroxypropyl)dodecanoate.
| Compound Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;2-hydroxypropanoyl 2-(2,3-dihydroxypropyl)dodecanoate |
|---|---|
| PubChem CID | 87823806 |
| Molecular Formula | C24H42O13 |
| Molecular Weight | 538.59 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;2-hydroxypropanoyl 2-(2,3-dihydroxypropyl)dodecanoate |
| SMILES | CCCCCCCCCCC(CC(O)CO)C(=O)OC(=O)C(C)O.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C18H34O6.C6H8O7/c1-3-4-5-6-7-8-9-10-11-15(12-16(21)13-19)18(23)24-17(22)14(2)20;7-3(8)1-6(13,5(11)12)2-4(9)10/h14-16,19-21H,3-13H2,1-2H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | ISIFYXFGFCPIHW-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 236.19 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.59 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|