C22H40O10 — CID 170160343
2-hexyldecanoic acid;2-(2-hydroperoxy-2-oxoethyl)-2-hydroxybutanedioic acid (PubChem CID 170160343) has the molecular formula C22H40O10 and a molecular weight of 464.55 g/mol. Its IUPAC name is 2-hexyldecanoic acid;2-(2-hydroperoxy-2-oxoethyl)-2-hydroxybutanedioic acid.
| Compound Name | 2-hexyldecanoic acid;2-(2-hydroperoxy-2-oxoethyl)-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 170160343 |
| Molecular Formula | C22H40O10 |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | 2-hexyldecanoic acid;2-(2-hydroperoxy-2-oxoethyl)-2-hydroxybutanedioic acid |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)O.O=C(O)CC(O)(CC(=O)OO)C(=O)O |
| InChI | InChI=1S/C16H32O2.C6H8O8/c1-3-5-7-9-10-12-14-15(16(17)18)13-11-8-6-4-2;7-3(8)1-6(12,5(10)11)2-4(9)14-13/h15H,3-14H2,1-2H3,(H,17,18);12-13H,1-2H2,(H,7,8)(H,10,11) |
| InChIKey | WPPOJWIJIDWGAJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 178.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|