C24H42O2 — CID 139750570
2,6-ditert-butyl-4-(7-methyloctoxymethyl)phenol (PubChem CID 139750570) has the molecular formula C24H42O2 and a molecular weight of 362.60 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-(7-methyloctoxymethyl)phenol.
| Compound Name | 2,6-ditert-butyl-4-(7-methyloctoxymethyl)phenol |
|---|---|
| PubChem CID | 139750570 |
| Molecular Formula | C24H42O2 |
| Molecular Weight | 362.60 g/mol |
| Exact Mass | 362.32 |
| IUPAC Name | 2,6-ditert-butyl-4-(7-methyloctoxymethyl)phenol |
| SMILES | CC(C)CCCCCCOCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H42O2/c1-18(2)13-11-9-10-12-14-26-17-19-15-20(23(3,4)5)22(25)21(16-19)24(6,7)8/h15-16,18,25H,9-14,17H2,1-8H3 |
| InChIKey | VSVOUXZBMMDYQK-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.60 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|