C24H42O — CID 91434310
2,6-ditert-butyl-4-(2-ethyl-6-methylheptyl)phenol (PubChem CID 91434310) has the molecular formula C24H42O and a molecular weight of 346.60 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-(2-ethyl-6-methylheptyl)phenol.
| Compound Name | 2,6-ditert-butyl-4-(2-ethyl-6-methylheptyl)phenol |
|---|---|
| PubChem CID | 91434310 |
| Molecular Formula | C24H42O |
| Molecular Weight | 346.60 g/mol |
| Exact Mass | 346.32 |
| IUPAC Name | 2,6-ditert-butyl-4-(2-ethyl-6-methylheptyl)phenol |
| SMILES | CCC(CCCC(C)C)Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H42O/c1-10-18(13-11-12-17(2)3)14-19-15-20(23(4,5)6)22(25)21(16-19)24(7,8)9/h15-18,25H,10-14H2,1-9H3 |
| InChIKey | RKQPTYKMEMXCSW-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.60 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |