C32H49NO4 — CID 88844038
2,6-ditert-butyl-4-[2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-3-nitropropyl]phenol (PubChem CID 88844038) has the molecular formula C32H49NO4 and a molecular weight of 511.75 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-3-nitropropyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-3-nitropropyl]phenol |
|---|---|
| PubChem CID | 88844038 |
| Molecular Formula | C32H49NO4 |
| Molecular Weight | 511.75 g/mol |
| Exact Mass | 511.37 |
| IUPAC Name | 2,6-ditert-butyl-4-[2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-3-nitropropyl]phenol |
| SMILES | CC(C)(C)c1cc(CC(Cc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)C[N+](=O)[O-])cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C32H49NO4/c1-29(2,3)23-15-20(16-24(27(23)34)30(4,5)6)13-22(19-33(36)37)14-21-17-25(31(7,8)9)28(35)26(18-21)32(10,11)12/h15-18,22,34-35H,13-14,19H2,1-12H3 |
| InChIKey | XEWAAHUZHVTLPG-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.75 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|