C27H50NO4P — CID 71661498
tributyl-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]phosphanium nitrate (PubChem CID 71661498) has the molecular formula C27H50NO4P and a molecular weight of 483.67 g/mol. Its IUPAC name is tributyl-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]phosphanium nitrate.
| Compound Name | tributyl-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]phosphanium nitrate |
|---|---|
| PubChem CID | 71661498 |
| Molecular Formula | C27H50NO4P |
| Molecular Weight | 483.67 g/mol |
| Exact Mass | 483.35 |
| IUPAC Name | tributyl-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]phosphanium nitrate |
| SMILES | CCCC[P+](CCCC)(CCCC)Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.O=[N+]([O-])[O-] |
| InChI | InChI=1S/C27H49OP.NO3/c1-10-13-16-29(17-14-11-2,18-15-12-3)21-22-19-23(26(4,5)6)25(28)24(20-22)27(7,8)9;2-1(3)4/h19-20H,10-18,21H2,1-9H3;/q;-1/p+1 |
| InChIKey | FGVSWSKAKJNPFS-UHFFFAOYSA-O |
| XLogP | 8.67 |
| TPSA | 86.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.67 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|