C46H69NO5 — CID 21434885
2,6-ditert-butyl-4-[3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2-nitropropyl]phenol (PubChem CID 21434885) has the molecular formula C46H69NO5 and a molecular weight of 716.06 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2-nitropropyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2-nitropropyl]phenol |
|---|---|
| PubChem CID | 21434885 |
| Molecular Formula | C46H69NO5 |
| Molecular Weight | 716.06 g/mol |
| Exact Mass | 715.52 |
| IUPAC Name | 2,6-ditert-butyl-4-[3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2-nitropropyl]phenol |
| SMILES | CC(C)(C)c1cc(CC(Cc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)(Cc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)[N+](=O)[O-])cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C46H69NO5/c1-40(2,3)31-19-28(20-32(37(31)48)41(4,5)6)25-46(47(51)52,26-29-21-33(42(7,8)9)38(49)34(22-29)43(10,11)12)27-30-23-35(44(13,14)15)39(50)36(24-30)45(16,17)18/h19-24,48-50H,25-27H2,1-18H3 |
| InChIKey | CQARNQLVHJYROJ-UHFFFAOYSA-N |
| XLogP | 11.63 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.06 |
| LogP ≤ 5 | 11.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|