C21H34O2S — CID 91194575
2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2-ethylbutanethioic S-acid (PubChem CID 91194575) has the molecular formula C21H34O2S and a molecular weight of 350.57 g/mol. Its IUPAC name is 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2-ethylbutanethioic S-acid.
| Compound Name | 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2-ethylbutanethioic S-acid |
|---|---|
| PubChem CID | 91194575 |
| Molecular Formula | C21H34O2S |
| Molecular Weight | 350.57 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2-ethylbutanethioic S-acid |
| SMILES | CCC(CC)(Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)C(=O)S |
| InChI | InChI=1S/C21H34O2S/c1-9-21(10-2,18(23)24)13-14-11-15(19(3,4)5)17(22)16(12-14)20(6,7)8/h11-12,22H,9-10,13H2,1-8H3,(H,23,24) |
| InChIKey | VDCUCACEWBNRLO-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.57 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|