C21H33ClO3 — CID 88750003
[3-(3,5-ditert-butyl-4-hydroxyphenyl)-2,2-dimethylpropyl] 2-chloroacetate (PubChem CID 88750003) has the molecular formula C21H33ClO3 and a molecular weight of 368.95 g/mol. Its IUPAC name is [3-(3,5-ditert-butyl-4-hydroxyphenyl)-2,2-dimethylpropyl] 2-chloroacetate.
| Compound Name | [3-(3,5-ditert-butyl-4-hydroxyphenyl)-2,2-dimethylpropyl] 2-chloroacetate |
|---|---|
| PubChem CID | 88750003 |
| Molecular Formula | C21H33ClO3 |
| Molecular Weight | 368.95 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | [3-(3,5-ditert-butyl-4-hydroxyphenyl)-2,2-dimethylpropyl] 2-chloroacetate |
| SMILES | CC(C)(COC(=O)CCl)Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C21H33ClO3/c1-19(2,3)15-9-14(10-16(18(15)24)20(4,5)6)11-21(7,8)13-25-17(23)12-22/h9-10,24H,11-13H2,1-8H3 |
| InChIKey | NUXPPBMKVAHUEW-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.95 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|