C22H34O5 — CID 87994184
3-[1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-methylbutan-2-yl]oxy-3-oxopropanoic acid (PubChem CID 87994184) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is 3-[1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-methylbutan-2-yl]oxy-3-oxopropanoic acid.
| Compound Name | 3-[1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-methylbutan-2-yl]oxy-3-oxopropanoic acid |
|---|---|
| PubChem CID | 87994184 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 3-[1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-methylbutan-2-yl]oxy-3-oxopropanoic acid |
| SMILES | CCC(C)(Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)OC(=O)CC(=O)O |
| InChI | InChI=1S/C22H34O5/c1-9-22(8,27-18(25)12-17(23)24)13-14-10-15(20(2,3)4)19(26)16(11-14)21(5,6)7/h10-11,26H,9,12-13H2,1-8H3,(H,23,24) |
| InChIKey | GEEKSJNGUFHLEP-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|