C35H52O6S — CID 90169511
2,2-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-3-oxo-3-(1-sulfanylethoxy)propanoic acid (PubChem CID 90169511) has the molecular formula C35H52O6S and a molecular weight of 600.86 g/mol. Its IUPAC name is 2,2-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-3-oxo-3-(1-sulfanylethoxy)propanoic acid.
| Compound Name | 2,2-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-3-oxo-3-(1-sulfanylethoxy)propanoic acid |
|---|---|
| PubChem CID | 90169511 |
| Molecular Formula | C35H52O6S |
| Molecular Weight | 600.86 g/mol |
| Exact Mass | 600.35 |
| IUPAC Name | 2,2-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-3-oxo-3-(1-sulfanylethoxy)propanoic acid |
| SMILES | CC(S)OC(=O)C(Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)(Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)C(=O)O |
| InChI | InChI=1S/C35H52O6S/c1-20(42)41-30(40)35(29(38)39,18-21-14-23(31(2,3)4)27(36)24(15-21)32(5,6)7)19-22-16-25(33(8,9)10)28(37)26(17-22)34(11,12)13/h14-17,20,36-37,42H,18-19H2,1-13H3,(H,38,39) |
| InChIKey | COFOWKMUKAKRKS-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.86 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|