C22H34O5 — CID 19898038
dimethyl 3-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]pentanedioate (PubChem CID 19898038) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is dimethyl 3-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]pentanedioate.
| Compound Name | dimethyl 3-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]pentanedioate |
|---|---|
| PubChem CID | 19898038 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | dimethyl 3-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]pentanedioate |
| SMILES | COC(=O)CC(CC(=O)OC)Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C22H34O5/c1-21(2,3)16-10-14(11-17(20(16)25)22(4,5)6)9-15(12-18(23)26-7)13-19(24)27-8/h10-11,15,25H,9,12-13H2,1-8H3 |
| InChIKey | KEQSXTOQZXUXAP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |