C18H27IO3 — CID 118054778
methyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-iodopropanoate (PubChem CID 118054778) has the molecular formula C18H27IO3 and a molecular weight of 418.32 g/mol. Its IUPAC name is methyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-iodopropanoate.
| Compound Name | methyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-iodopropanoate |
|---|---|
| PubChem CID | 118054778 |
| Molecular Formula | C18H27IO3 |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | methyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-iodopropanoate |
| SMILES | COC(=O)C(I)Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H27IO3/c1-17(2,3)12-8-11(10-14(19)16(21)22-7)9-13(15(12)20)18(4,5)6/h8-9,14,20H,10H2,1-7H3 |
| InChIKey | WUEWCJMWMTVTFP-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|