C15H19O5- — CID 23341427
2-[(3-tert-butyl-4-hydroxyphenyl)methyl]-3-methoxy-3-oxopropanoate (PubChem CID 23341427) has the molecular formula C15H19O5- and a molecular weight of 279.31 g/mol. Its IUPAC name is 2-[(3-tert-butyl-4-hydroxyphenyl)methyl]-3-methoxy-3-oxopropanoate.
| Compound Name | 2-[(3-tert-butyl-4-hydroxyphenyl)methyl]-3-methoxy-3-oxopropanoate |
|---|---|
| PubChem CID | 23341427 |
| Molecular Formula | C15H19O5- |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 2-[(3-tert-butyl-4-hydroxyphenyl)methyl]-3-methoxy-3-oxopropanoate |
| SMILES | COC(=O)C(Cc1ccc(O)c(C(C)(C)C)c1)C(=O)[O-] |
| InChI | InChI=1S/C15H20O5/c1-15(2,3)11-8-9(5-6-12(11)16)7-10(13(17)18)14(19)20-4/h5-6,8,10,16H,7H2,1-4H3,(H,17,18)/p-1 |
| InChIKey | YIJRLDPXKIUELJ-UHFFFAOYSA-M |
| XLogP | 0.77 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|