C19H27O3- — CID 6432878
(Z)-3-[(3-tert-butyl-4-hydroxyphenyl)methyl]-2,4,4-trimethylpent-2-enoate (PubChem CID 6432878) has the molecular formula C19H27O3- and a molecular weight of 303.42 g/mol. Its IUPAC name is (Z)-3-[(3-tert-butyl-4-hydroxyphenyl)methyl]-2,4,4-trimethylpent-2-enoate.
| Compound Name | (Z)-3-[(3-tert-butyl-4-hydroxyphenyl)methyl]-2,4,4-trimethylpent-2-enoate |
|---|---|
| PubChem CID | 6432878 |
| Molecular Formula | C19H27O3- |
| Molecular Weight | 303.42 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | (Z)-3-[(3-tert-butyl-4-hydroxyphenyl)methyl]-2,4,4-trimethylpent-2-enoate |
| SMILES | C/C(C(=O)[O-])=C(\Cc1ccc(O)c(C(C)(C)C)c1)C(C)(C)C |
| InChI | InChI=1S/C19H28O3/c1-12(17(21)22)14(18(2,3)4)10-13-8-9-16(20)15(11-13)19(5,6)7/h8-9,11,20H,10H2,1-7H3,(H,21,22)/p-1/b14-12- |
| InChIKey | DZOOKHXPUZLQPB-OWBHPGMISA-M |
| XLogP | 3.34 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|