C33H42O5 — CID 175040042
2,2,3-tris(3-tert-butyl-4-hydroxyphenyl)propanoic acid (PubChem CID 175040042) has the molecular formula C33H42O5 and a molecular weight of 518.69 g/mol. Its IUPAC name is 2,2,3-tris(3-tert-butyl-4-hydroxyphenyl)propanoic acid.
| Compound Name | 2,2,3-tris(3-tert-butyl-4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 175040042 |
| Molecular Formula | C33H42O5 |
| Molecular Weight | 518.69 g/mol |
| Exact Mass | 518.30 |
| IUPAC Name | 2,2,3-tris(3-tert-butyl-4-hydroxyphenyl)propanoic acid |
| SMILES | CC(C)(C)c1cc(CC(C(=O)O)(c2ccc(O)c(C(C)(C)C)c2)c2ccc(O)c(C(C)(C)C)c2)ccc1O |
| InChI | InChI=1S/C33H42O5/c1-30(2,3)23-16-20(10-13-26(23)34)19-33(29(37)38,21-11-14-27(35)24(17-21)31(4,5)6)22-12-15-28(36)25(18-22)32(7,8)9/h10-18,34-36H,19H2,1-9H3,(H,37,38) |
| InChIKey | XGURUSQSDJPKTC-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.69 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |