C25H34O3 — CID 88553767
4,4-bis(3-tert-butyl-4-hydroxyphenyl)pentan-2-one (PubChem CID 88553767) has the molecular formula C25H34O3 and a molecular weight of 382.54 g/mol. Its IUPAC name is 4,4-bis(3-tert-butyl-4-hydroxyphenyl)pentan-2-one.
| Compound Name | 4,4-bis(3-tert-butyl-4-hydroxyphenyl)pentan-2-one |
|---|---|
| PubChem CID | 88553767 |
| Molecular Formula | C25H34O3 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | 4,4-bis(3-tert-butyl-4-hydroxyphenyl)pentan-2-one |
| SMILES | CC(=O)CC(C)(c1ccc(O)c(C(C)(C)C)c1)c1ccc(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C25H34O3/c1-16(26)15-25(8,17-9-11-21(27)19(13-17)23(2,3)4)18-10-12-22(28)20(14-18)24(5,6)7/h9-14,27-28H,15H2,1-8H3 |
| InChIKey | OCVWMNCJOZEPAQ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |