C32H48O4 — CID 151797851
octyl 3,3-bis(3-tert-butyl-4-hydroxyphenyl)butanoate (PubChem CID 151797851) has the molecular formula C32H48O4 and a molecular weight of 496.73 g/mol. Its IUPAC name is octyl 3,3-bis(3-tert-butyl-4-hydroxyphenyl)butanoate.
| Compound Name | octyl 3,3-bis(3-tert-butyl-4-hydroxyphenyl)butanoate |
|---|---|
| PubChem CID | 151797851 |
| Molecular Formula | C32H48O4 |
| Molecular Weight | 496.73 g/mol |
| Exact Mass | 496.36 |
| IUPAC Name | octyl 3,3-bis(3-tert-butyl-4-hydroxyphenyl)butanoate |
| SMILES | CCCCCCCCOC(=O)CC(C)(c1ccc(O)c(C(C)(C)C)c1)c1ccc(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C32H48O4/c1-9-10-11-12-13-14-19-36-29(35)22-32(8,23-15-17-27(33)25(20-23)30(2,3)4)24-16-18-28(34)26(21-24)31(5,6)7/h15-18,20-21,33-34H,9-14,19,22H2,1-8H3 |
| InChIKey | RXZAPQOBZRGPGZ-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.73 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|