C19H30O3 — CID 174435371
hexyl 2-[4-hydroxy-3-(2-methylbutan-2-yl)phenyl]acetate (PubChem CID 174435371) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is hexyl 2-[4-hydroxy-3-(2-methylbutan-2-yl)phenyl]acetate.
| Compound Name | hexyl 2-[4-hydroxy-3-(2-methylbutan-2-yl)phenyl]acetate |
|---|---|
| PubChem CID | 174435371 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | hexyl 2-[4-hydroxy-3-(2-methylbutan-2-yl)phenyl]acetate |
| SMILES | CCCCCCOC(=O)Cc1ccc(O)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C19H30O3/c1-5-7-8-9-12-22-18(21)14-15-10-11-17(20)16(13-15)19(3,4)6-2/h10-11,13,20H,5-9,12,14H2,1-4H3 |
| InChIKey | ZTPGTHWXRMOLFT-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|