C26H44O3 — CID 175293539
decyl 3-[4-hydroxy-3-(2-methylhexan-2-yl)phenyl]propanoate (PubChem CID 175293539) has the molecular formula C26H44O3 and a molecular weight of 404.64 g/mol. Its IUPAC name is decyl 3-[4-hydroxy-3-(2-methylhexan-2-yl)phenyl]propanoate.
| Compound Name | decyl 3-[4-hydroxy-3-(2-methylhexan-2-yl)phenyl]propanoate |
|---|---|
| PubChem CID | 175293539 |
| Molecular Formula | C26H44O3 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.33 |
| IUPAC Name | decyl 3-[4-hydroxy-3-(2-methylhexan-2-yl)phenyl]propanoate |
| SMILES | CCCCCCCCCCOC(=O)CCc1ccc(O)c(C(C)(C)CCCC)c1 |
| InChI | InChI=1S/C26H44O3/c1-5-7-9-10-11-12-13-14-20-29-25(28)18-16-22-15-17-24(27)23(21-22)26(3,4)19-8-6-2/h15,17,21,27H,5-14,16,18-20H2,1-4H3 |
| InChIKey | VGWUMZONKJILDS-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|