C36H56O5 — CID 88821309
4-hydroxybutyl 3,3-bis(3,5-ditert-butyl-4-hydroxyphenyl)butanoate (PubChem CID 88821309) has the molecular formula C36H56O5 and a molecular weight of 568.84 g/mol. Its IUPAC name is 4-hydroxybutyl 3,3-bis(3,5-ditert-butyl-4-hydroxyphenyl)butanoate.
| Compound Name | 4-hydroxybutyl 3,3-bis(3,5-ditert-butyl-4-hydroxyphenyl)butanoate |
|---|---|
| PubChem CID | 88821309 |
| Molecular Formula | C36H56O5 |
| Molecular Weight | 568.84 g/mol |
| Exact Mass | 568.41 |
| IUPAC Name | 4-hydroxybutyl 3,3-bis(3,5-ditert-butyl-4-hydroxyphenyl)butanoate |
| SMILES | CC(C)(C)c1cc(C(C)(CC(=O)OCCCCO)c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C36H56O5/c1-32(2,3)25-18-23(19-26(30(25)39)33(4,5)6)36(13,22-29(38)41-17-15-14-16-37)24-20-27(34(7,8)9)31(40)28(21-24)35(10,11)12/h18-21,37,39-40H,14-17,22H2,1-13H3 |
| InChIKey | FRDPBPWBVXLIDG-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.84 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|