C23H39NO5 — CID 88599842
4-(4-hydroxybutoxy)butyl N-(3,5-ditert-butyl-4-hydroxyphenyl)carbamate (PubChem CID 88599842) has the molecular formula C23H39NO5 and a molecular weight of 409.57 g/mol. Its IUPAC name is 4-(4-hydroxybutoxy)butyl N-(3,5-ditert-butyl-4-hydroxyphenyl)carbamate.
| Compound Name | 4-(4-hydroxybutoxy)butyl N-(3,5-ditert-butyl-4-hydroxyphenyl)carbamate |
|---|---|
| PubChem CID | 88599842 |
| Molecular Formula | C23H39NO5 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.28 |
| IUPAC Name | 4-(4-hydroxybutoxy)butyl N-(3,5-ditert-butyl-4-hydroxyphenyl)carbamate |
| SMILES | CC(C)(C)c1cc(NC(=O)OCCCCOCCCCO)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C23H39NO5/c1-22(2,3)18-15-17(16-19(20(18)26)23(4,5)6)24-21(27)29-14-10-9-13-28-12-8-7-11-25/h15-16,25-26H,7-14H2,1-6H3,(H,24,27) |
| InChIKey | IYQWQVCEZHAVGF-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|