C19H32O3 — CID 21199265
2,6-ditert-butyl-4-(3-hydroxypropoxymethyl)-3-methylphenol (PubChem CID 21199265) has the molecular formula C19H32O3 and a molecular weight of 308.46 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-(3-hydroxypropoxymethyl)-3-methylphenol.
| Compound Name | 2,6-ditert-butyl-4-(3-hydroxypropoxymethyl)-3-methylphenol |
|---|---|
| PubChem CID | 21199265 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | 2,6-ditert-butyl-4-(3-hydroxypropoxymethyl)-3-methylphenol |
| SMILES | Cc1c(COCCCO)cc(C(C)(C)C)c(O)c1C(C)(C)C |
| InChI | InChI=1S/C19H32O3/c1-13-14(12-22-10-8-9-20)11-15(18(2,3)4)17(21)16(13)19(5,6)7/h11,20-21H,8-10,12H2,1-7H3 |
| InChIKey | SYJRWIGSBNXZTA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|