C19H30O3 — CID 123527017
(3,5-ditert-butyl-4-hydroxy-2-methylphenyl) 2-methylpropanoate (PubChem CID 123527017) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is (3,5-ditert-butyl-4-hydroxy-2-methylphenyl) 2-methylpropanoate.
| Compound Name | (3,5-ditert-butyl-4-hydroxy-2-methylphenyl) 2-methylpropanoate |
|---|---|
| PubChem CID | 123527017 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | (3,5-ditert-butyl-4-hydroxy-2-methylphenyl) 2-methylpropanoate |
| SMILES | Cc1c(OC(=O)C(C)C)cc(C(C)(C)C)c(O)c1C(C)(C)C |
| InChI | InChI=1S/C19H30O3/c1-11(2)17(21)22-14-10-13(18(4,5)6)16(20)15(12(14)3)19(7,8)9/h10-11,20H,1-9H3 |
| InChIKey | ACDUMMWJTDEJFO-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|