C19H31NO3 — CID 19363191
(3,5-ditert-butyl-4-hydroxy-2-propan-2-ylphenyl) 2-aminoacetate (PubChem CID 19363191) has the molecular formula C19H31NO3 and a molecular weight of 321.46 g/mol. Its IUPAC name is (3,5-ditert-butyl-4-hydroxy-2-propan-2-ylphenyl) 2-aminoacetate.
| Compound Name | (3,5-ditert-butyl-4-hydroxy-2-propan-2-ylphenyl) 2-aminoacetate |
|---|---|
| PubChem CID | 19363191 |
| Molecular Formula | C19H31NO3 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | (3,5-ditert-butyl-4-hydroxy-2-propan-2-ylphenyl) 2-aminoacetate |
| SMILES | CC(C)c1c(OC(=O)CN)cc(C(C)(C)C)c(O)c1C(C)(C)C |
| InChI | InChI=1S/C19H31NO3/c1-11(2)15-13(23-14(21)10-20)9-12(18(3,4)5)17(22)16(15)19(6,7)8/h9,11,22H,10,20H2,1-8H3 |
| InChIKey | CUIVXZWISDKTJF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|