C19H28O4 — CID 154392115
(3,5-ditert-butyl-4-hydroxyphenyl)methyl 3-oxobutanoate (PubChem CID 154392115) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is (3,5-ditert-butyl-4-hydroxyphenyl)methyl 3-oxobutanoate.
| Compound Name | (3,5-ditert-butyl-4-hydroxyphenyl)methyl 3-oxobutanoate |
|---|---|
| PubChem CID | 154392115 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | (3,5-ditert-butyl-4-hydroxyphenyl)methyl 3-oxobutanoate |
| SMILES | CC(=O)CC(=O)OCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H28O4/c1-12(20)8-16(21)23-11-13-9-14(18(2,3)4)17(22)15(10-13)19(5,6)7/h9-10,22H,8,11H2,1-7H3 |
| InChIKey | FCWPXSDVOUFYGN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|