C17H24O4 — CID 123907689
methyl 3-(3-tert-butyl-4-hydroxy-5-propan-2-ylphenyl)-3-oxopropanoate (PubChem CID 123907689) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is methyl 3-(3-tert-butyl-4-hydroxy-5-propan-2-ylphenyl)-3-oxopropanoate.
| Compound Name | methyl 3-(3-tert-butyl-4-hydroxy-5-propan-2-ylphenyl)-3-oxopropanoate |
|---|---|
| PubChem CID | 123907689 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | methyl 3-(3-tert-butyl-4-hydroxy-5-propan-2-ylphenyl)-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)c1cc(C(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C17H24O4/c1-10(2)12-7-11(14(18)9-15(19)21-6)8-13(16(12)20)17(3,4)5/h7-8,10,20H,9H2,1-6H3 |
| InChIKey | JGIZITMTKLHJFG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|