C35H54O6 — CID 87557993
2-(2-hydroxyethoxy)ethyl 2,2-bis(3,5-ditert-butyl-4-hydroxyphenyl)propanoate (PubChem CID 87557993) has the molecular formula C35H54O6 and a molecular weight of 570.81 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethyl 2,2-bis(3,5-ditert-butyl-4-hydroxyphenyl)propanoate.
| Compound Name | 2-(2-hydroxyethoxy)ethyl 2,2-bis(3,5-ditert-butyl-4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 87557993 |
| Molecular Formula | C35H54O6 |
| Molecular Weight | 570.81 g/mol |
| Exact Mass | 570.39 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethyl 2,2-bis(3,5-ditert-butyl-4-hydroxyphenyl)propanoate |
| SMILES | CC(C)(C)c1cc(C(C)(C(=O)OCCOCCO)c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C35H54O6/c1-31(2,3)24-18-22(19-25(28(24)37)32(4,5)6)35(13,30(39)41-17-16-40-15-14-36)23-20-26(33(7,8)9)29(38)27(21-23)34(10,11)12/h18-21,36-38H,14-17H2,1-13H3 |
| InChIKey | LXWMBMLOQRKQOU-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.81 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|