C33H50O7 — CID 156896288
2-[2-(2-hydroxyethoxy)ethoxy]ethyl 2,2-bis(3-tert-butyl-5-ethyl-4-hydroxyphenyl)propanoate (PubChem CID 156896288) has the molecular formula C33H50O7 and a molecular weight of 558.76 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethoxy)ethoxy]ethyl 2,2-bis(3-tert-butyl-5-ethyl-4-hydroxyphenyl)propanoate.
| Compound Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethyl 2,2-bis(3-tert-butyl-5-ethyl-4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 156896288 |
| Molecular Formula | C33H50O7 |
| Molecular Weight | 558.76 g/mol |
| Exact Mass | 558.36 |
| IUPAC Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethyl 2,2-bis(3-tert-butyl-5-ethyl-4-hydroxyphenyl)propanoate |
| SMILES | CCc1cc(C(C)(C(=O)OCCOCCOCCO)c2cc(CC)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C33H50O7/c1-10-22-18-24(20-26(28(22)35)31(3,4)5)33(9,30(37)40-17-16-39-15-14-38-13-12-34)25-19-23(11-2)29(36)27(21-25)32(6,7)8/h18-21,34-36H,10-17H2,1-9H3 |
| InChIKey | CDBFOKBIXBIBQV-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.76 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|